Granulite outcrop, Waldheim, Mittelsachsen, Saxony, Germanyi
| Regional Level Types | |
|---|---|
| Granulite outcrop | Outcrop |
| Waldheim | Municipality |
| Mittelsachsen | District |
| Saxony | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
51° 4' 42'' North , 13° 0' 49'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Waldheim | 9,001 (2015) | 0.8km |
| Kriebstein | 2,710 (2014) | 3.2km |
| Hartha | 7,227 (2015) | 3.6km |
| Gersdorf | 1,307 (2015) | 6.4km |
| Ebersbach | 1,161 (2018) | 7.3km |
Name(s) in local language(s):
Granulitaufschluss, Waldheim, Döbeln, Sachsen, Deutschland
Outcrop of a hydrothermally altered granulite, located just east of the Waldheim freight depot. Today inaccessible.
Located about 10 km SW of Döbeln.
Prismatine from this locality was considered as kornerupine for a long time before it was eventually recognised as a new mineral. Older specimens, therefore, may still be labelled as kornerupine. The latter, however, does not occur here.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
24 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Anorthoclase Formula: (Na,K)AlSi3O8 |
| ⓘ Baryte Formula: BaSO4 References: "Steffen Michalski Collection"Identified by Steffen Michalski: Visual Identification |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Coesite Formula: SiO2 References: |
| ⓘ Corundum Formula: Al2O3 References: |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Cristobalite Formula: SiO2 |
| ⓘ Diamond Formula: C |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ 'Feldspar Group' |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ 'Hydromuscovite' |
| ⓘ Kokchetavite Formula: K(AlSi3O8) |
| ⓘ Formula: Mg3Al6(Si,Al,B)5O21(OH) Description: In modern times recognised as different from kornerupine and being prismatine (Grew et al., 1996). |
| ⓘ Kumdykolite Formula: Na(AlSi3O8) |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Moissanite Formula: SiC |
| ⓘ Prismatine (TL) Formula: (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 Type Locality: References: de Villiers, J. E. (1940) Iron-rich kornerupine from Port Shepstone, Natal. Mineralogical Magazine and Journal of the Mineralogical Society, 25 (169) 550-556 doi:10.1180/minmag.1940.025.169.05 (contains an analysis of "kornerupine var. prismatine" from Waldheim). |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Reidite Formula: Zr(SiO4) |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Stishovite Formula: SiO2 |
| ⓘ Tridymite Formula: SiO2 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Diamond | 1.CB.10a | C |
| ⓘ | Moissanite | 1.DA. | SiC |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Tridymite | 4.DA.10 | SiO2 |
| ⓘ | Cristobalite | 4.DA.15 | SiO2 |
| ⓘ | Coesite | 4.DA.35 | SiO2 |
| ⓘ | Stishovite | 4.DA.40 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Reidite | 9.AD.45 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Kornerupine ? | 9.BJ.50 | Mg3Al6(Si,Al,B)5O21(OH) |
| ⓘ | Prismatine (TL) | 9.BJ.50 | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Anorthoclase | 9.FA.35 | (Na,K)AlSi3O8 |
| ⓘ | Kumdykolite | 9.FA.45 | Na(AlSi3O8) |
| ⓘ | Kokchetavite | 9.FA.75 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Hydromuscovite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| C | Carbon | |
| C | ⓘ Diamond | C |
| C | ⓘ Moissanite | SiC |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coesite | SiO2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Cristobalite | SiO2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Stishovite | SiO2 |
| O | ⓘ Tridymite | SiO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Reidite | Zr(SiO4) |
| O | ⓘ Kokchetavite | K(AlSi3O8) |
| O | ⓘ Kumdykolite | Na(AlSi3O8) |
| F | Fluorine | |
| F | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Kumdykolite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Al | ⓘ Kokchetavite | K(AlSi3O8) |
| Al | ⓘ Kumdykolite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Coesite | SiO2 |
| Si | ⓘ Cristobalite | SiO2 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Kornerupine | Mg3Al6(Si,Al,B)5O21(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Moissanite | SiC |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Stishovite | SiO2 |
| Si | ⓘ Tridymite | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Reidite | Zr(SiO4) |
| Si | ⓘ Kokchetavite | K(AlSi3O8) |
| Si | ⓘ Kumdykolite | Na(AlSi3O8) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| K | Potassium | |
| K | ⓘ Albite var. Anorthoclase | (Na,K)AlSi3O8 |
| K | ⓘ Kokchetavite | K(AlSi3O8) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Prismatine | (◻,Fe,Mg)(Mg,Al,Fe)5Al4Si2(Si,Al)2(B,Si,Al)(O,OH,F)22 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Reidite | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
de Villiers, J. E. (1940) Iron-rich kornerupine from Port Shepstone, Natal. Mineralogical Magazine and Journal of the Mineralogical Society, 25 (169) 550-556 doi:10.1180/minmag.1940.025.169.05 (contains an analysis of "kornerupine var. prismatine" from Waldheim)




Granulite outcrop, Waldheim, Mittelsachsen, Saxony, Germany